C25H27N3O5S2 — CID 4681528
ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-ethyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4681528) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-ethyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4681528 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | ethyl 2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-3-ethyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(C(=O)OCC)ccc3n2CC)cc1 |
| InChI | InChI=1S/C25H27N3O5S2/c1-5-15-27(16-6-2)35(31,32)20-12-9-18(10-13-20)23(29)26-25-28(7-3)21-14-11-19(17-22(21)34-25)24(30)33-8-4/h5-6,9-14,17H,1-2,7-8,15-16H2,3-4H3/b26-25- |
| InChIKey | VEQXYOYIZZQJAP-QPLCGJKRSA-N |
| XLogP | 4.00 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|