C28H27N3O5S2 — CID 3650493
ethyl 2-[4-[benzyl(methyl)sulfamoyl]benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3650493) has the molecular formula C28H27N3O5S2 and a molecular weight of 549.67 g/mol. Its IUPAC name is ethyl 2-[4-[benzyl(methyl)sulfamoyl]benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-[benzyl(methyl)sulfamoyl]benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3650493 |
| Molecular Formula | C28H27N3O5S2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | ethyl 2-[4-[benzyl(methyl)sulfamoyl]benzoyl]imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C28H27N3O5S2/c1-4-17-31-24-16-13-22(27(33)36-5-2)18-25(24)37-28(31)29-26(32)21-11-14-23(15-12-21)38(34,35)30(3)19-20-9-7-6-8-10-20/h4,6-16,18H,1,5,17,19H2,2-3H3/b29-28- |
| InChIKey | BCGUVZFIYCVZIO-ZIADKAODSA-N |
| XLogP | 4.63 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|