C20H16Cl2N2O3S — CID 4191874
ethyl 2-(3,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4191874) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is ethyl 2-(3,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(3,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4191874 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | ethyl 2-(3,5-dichlorobenzoyl)imino-3-prop-2-enyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(Cl)cc(Cl)c2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C20H16Cl2N2O3S/c1-3-7-24-16-6-5-12(19(26)27-4-2)10-17(16)28-20(24)23-18(25)13-8-14(21)11-15(22)9-13/h3,5-6,8-11H,1,4,7H2,2H3/b23-20- |
| InChIKey | BNEDUPLMQRGYPJ-ATJXCDBQSA-N |
| XLogP | 5.11 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|