C18H16N2O3S2 — CID 3290941
ethyl 3-prop-2-enyl-2-(thiophene-2-carbonylimino)-1,3-benzothiazole-6-carboxylate (PubChem CID 3290941) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl 3-prop-2-enyl-2-(thiophene-2-carbonylimino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-prop-2-enyl-2-(thiophene-2-carbonylimino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3290941 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | ethyl 3-prop-2-enyl-2-(thiophene-2-carbonylimino)-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)c2cccs2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C18H16N2O3S2/c1-3-9-20-13-8-7-12(17(22)23-4-2)11-15(13)25-18(20)19-16(21)14-6-5-10-24-14/h3,5-8,10-11H,1,4,9H2,2H3/b19-18- |
| InChIKey | SDUJIFZCMITSOG-HNENSFHCSA-N |
| XLogP | 3.87 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|