C19H17ClN2O2S — CID 4613615
N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-ethoxybenzamide (PubChem CID 4613615) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-ethoxybenzamide.
| Compound Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 4613615 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-ethoxybenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(OCC)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H17ClN2O2S/c1-3-11-22-16-10-7-14(20)12-17(16)25-19(22)21-18(23)13-5-8-15(9-6-13)24-4-2/h3,5-10,12H,1,4,11H2,2H3/b21-19- |
| InChIKey | RJGZPMCACINUHR-VZCXRCSSSA-N |
| XLogP | 4.68 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|