C19H16ClN3O4S — CID 5091416
5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide (PubChem CID 5091416) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is 5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
|---|---|
| PubChem CID | 5091416 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 5-chloro-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-3-9-22-16-8-6-13(27-4-2)11-17(16)28-19(22)21-18(24)14-10-12(20)5-7-15(14)23(25)26/h3,5-8,10-11H,1,4,9H2,2H3/b21-19- |
| InChIKey | FOQPKCQVNSFLIG-VZCXRCSSSA-N |
| XLogP | 4.59 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|