C20H18ClN3O6S — CID 3562157
ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 3562157) has the molecular formula C20H18ClN3O6S and a molecular weight of 463.90 g/mol. Its IUPAC name is ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 3562157 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C20H18ClN3O6S/c1-3-29-13-6-8-16-17(10-13)31-20(23(16)11-18(25)30-4-2)22-19(26)14-9-12(21)5-7-15(14)24(27)28/h5-10H,3-4,11H2,1-2H3/b22-20- |
| InChIKey | SXUNDIHIWNPOQW-XDOYNYLZSA-N |
| XLogP | 3.97 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|