C20H18N4O8S — CID 4097253
ethyl 2-[2-(3,5-dinitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 4097253) has the molecular formula C20H18N4O8S and a molecular weight of 474.45 g/mol. Its IUPAC name is ethyl 2-[2-(3,5-dinitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(3,5-dinitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4097253 |
| Molecular Formula | C20H18N4O8S |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | ethyl 2-[2-(3,5-dinitrobenzoyl)imino-6-ethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C20H18N4O8S/c1-3-31-15-5-6-16-17(10-15)33-20(22(16)11-18(25)32-4-2)21-19(26)12-7-13(23(27)28)9-14(8-12)24(29)30/h5-10H,3-4,11H2,1-2H3/b21-20- |
| InChIKey | WLAPGLUAWUYJMP-MRCUWXFGSA-N |
| XLogP | 3.22 |
| TPSA | 156.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|