C18H13ClN4O7S — CID 4296735
ethyl 2-[2-(2-chloro-5-nitrobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 4296735) has the molecular formula C18H13ClN4O7S and a molecular weight of 464.84 g/mol. Its IUPAC name is ethyl 2-[2-(2-chloro-5-nitrobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-chloro-5-nitrobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4296735 |
| Molecular Formula | C18H13ClN4O7S |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | ethyl 2-[2-(2-chloro-5-nitrobenzoyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc([N+](=O)[O-])ccc2Cl)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H13ClN4O7S/c1-2-30-16(24)9-21-14-6-4-11(23(28)29)8-15(14)31-18(21)20-17(25)12-7-10(22(26)27)3-5-13(12)19/h3-8H,2,9H2,1H3/b20-18- |
| InChIKey | HFAIQPFSGDMOPW-ZZEZOPTASA-N |
| XLogP | 3.48 |
| TPSA | 146.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|