C15H12N4O6S — CID 41149741
ethyl 2-[6-nitro-2-(1,2-oxazole-5-carbonylimino)-1,3-benzothiazol-3-yl]acetate (PubChem CID 41149741) has the molecular formula C15H12N4O6S and a molecular weight of 376.35 g/mol. Its IUPAC name is ethyl 2-[6-nitro-2-(1,2-oxazole-5-carbonylimino)-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-nitro-2-(1,2-oxazole-5-carbonylimino)-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41149741 |
| Molecular Formula | C15H12N4O6S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | ethyl 2-[6-nitro-2-(1,2-oxazole-5-carbonylimino)-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccno2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H12N4O6S/c1-2-24-13(20)8-18-10-4-3-9(19(22)23)7-12(10)26-15(18)17-14(21)11-5-6-16-25-11/h3-7H,2,8H2,1H3/b17-15- |
| InChIKey | CXPLQKUBWONNFB-ICFOKQHNSA-N |
| XLogP | 1.90 |
| TPSA | 129.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|