C16H13N5O5S — CID 43941224
ethyl 2-[6-nitro-2-(pyrazine-2-carbonylimino)-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941224) has the molecular formula C16H13N5O5S and a molecular weight of 387.38 g/mol. Its IUPAC name is ethyl 2-[6-nitro-2-(pyrazine-2-carbonylimino)-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-nitro-2-(pyrazine-2-carbonylimino)-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941224 |
| Molecular Formula | C16H13N5O5S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | ethyl 2-[6-nitro-2-(pyrazine-2-carbonylimino)-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cnccn2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H13N5O5S/c1-2-26-14(22)9-20-12-4-3-10(21(24)25)7-13(12)27-16(20)19-15(23)11-8-17-5-6-18-11/h3-8H,2,9H2,1H3/b19-16- |
| InChIKey | MYEQUSFXMPWYCM-MNDPQUGUSA-N |
| XLogP | 1.71 |
| TPSA | 129.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|