C22H19N3O7S — CID 40889859
ethyl 2-[2-(7-ethoxy-1-benzofuran-2-carbonyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 40889859) has the molecular formula C22H19N3O7S and a molecular weight of 469.48 g/mol. Its IUPAC name is ethyl 2-[2-(7-ethoxy-1-benzofuran-2-carbonyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(7-ethoxy-1-benzofuran-2-carbonyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40889859 |
| Molecular Formula | C22H19N3O7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | ethyl 2-[2-(7-ethoxy-1-benzofuran-2-carbonyl)imino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H19N3O7S/c1-3-30-16-7-5-6-13-10-17(32-20(13)16)21(27)23-22-24(12-19(26)31-4-2)15-9-8-14(25(28)29)11-18(15)33-22/h5-11H,3-4,12H2,1-2H3/b23-22- |
| InChIKey | REFFZKOHQOWLJM-FCQUAONHSA-N |
| XLogP | 4.06 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|