C20H14N4O7S2 — CID 4677886
ethyl 2-[6-nitro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4677886) has the molecular formula C20H14N4O7S2 and a molecular weight of 486.49 g/mol. Its IUPAC name is ethyl 2-[6-nitro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-nitro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4677886 |
| Molecular Formula | C20H14N4O7S2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | ethyl 2-[6-nitro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H14N4O7S2/c1-2-31-18(25)10-22-14-5-3-13(24(29)30)9-16(14)33-20(22)21-19(26)17-8-11-7-12(23(27)28)4-6-15(11)32-17/h3-9H,2,10H2,1H3/b21-20- |
| InChIKey | ICOSDAZDWRQJTR-MRCUWXFGSA-N |
| XLogP | 4.04 |
| TPSA | 146.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|