C19H10N4O5S2 — CID 4206222
5-nitro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide (PubChem CID 4206222) has the molecular formula C19H10N4O5S2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 5-nitro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4206222 |
| Molecular Formula | C19H10N4O5S2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 5-nitro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzothiophene-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H10N4O5S2/c1-2-7-21-14-5-3-13(23(27)28)10-16(14)30-19(21)20-18(24)17-9-11-8-12(22(25)26)4-6-15(11)29-17/h1,3-6,8-10H,7H2/b20-19- |
| InChIKey | WHEBCBTUDIATGO-VXPUYCOJSA-N |
| XLogP | 4.11 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|