C20H17N3O3S2 — CID 43983991
N-(6-methyl-3-propyl-1,3-benzothiazol-2-ylidene)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 43983991) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-(6-methyl-3-propyl-1,3-benzothiazol-2-ylidene)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-methyl-3-propyl-1,3-benzothiazol-2-ylidene)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43983991 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-(6-methyl-3-propyl-1,3-benzothiazol-2-ylidene)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCCn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C20H17N3O3S2/c1-3-8-22-15-6-4-12(2)9-17(15)28-20(22)21-19(24)18-11-13-10-14(23(25)26)5-7-16(13)27-18/h4-7,9-11H,3,8H2,1-2H3/b21-20- |
| InChIKey | AOXMMUJAQMFFMA-MRCUWXFGSA-N |
| XLogP | 5.29 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|