C19H20N4O3S — CID 8612961
4-(dimethylamino)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 8612961) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(dimethylamino)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 8612961 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-(dimethylamino)-N-(6-nitro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccc(N(C)C)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H20N4O3S/c1-4-11-22-16-10-9-15(23(25)26)12-17(16)27-19(22)20-18(24)13-5-7-14(8-6-13)21(2)3/h5-10,12H,4,11H2,1-3H3/b20-19- |
| InChIKey | DZLOWXAVEKAQMY-VXPUYCOJSA-N |
| XLogP | 3.83 |
| TPSA | 80.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|