C17H14N4O5S2 — CID 41125182
N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide (PubChem CID 41125182) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41125182 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H14N4O5S2/c1-27-9-8-19-14-7-6-13(21(25)26)10-15(14)28-17(19)18-16(22)11-2-4-12(5-3-11)20(23)24/h2-7,10H,8-9H2,1H3/b18-17- |
| InChIKey | LFCCSKMHZHDMQU-ZCXUNETKSA-N |
| XLogP | 3.62 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|