C19H19N3O5S3 — CID 42522910
N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 42522910) has the molecular formula C19H19N3O5S3 and a molecular weight of 465.58 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42522910 |
| Molecular Formula | C19H19N3O5S3 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CSCCn1/c(=N/C(=O)Cc2ccc(S(C)(=O)=O)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H19N3O5S3/c1-28-10-9-21-16-8-5-14(22(24)25)12-17(16)29-19(21)20-18(23)11-13-3-6-15(7-4-13)30(2,26)27/h3-8,12H,9-11H2,1-2H3/b20-19- |
| InChIKey | BUKIBBLUMFFJML-VXPUYCOJSA-N |
| XLogP | 3.05 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|