C18H17N3O5S3 — CID 41125498
N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide (PubChem CID 41125498) has the molecular formula C18H17N3O5S3 and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41125498 |
| Molecular Formula | C18H17N3O5S3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H17N3O5S3/c1-27-10-9-20-15-8-7-14(29(2,25)26)11-16(15)28-18(20)19-17(22)12-3-5-13(6-4-12)21(23)24/h3-8,11H,9-10H2,1-2H3/b19-18- |
| InChIKey | DCOSXOVJWDPWJF-HNENSFHCSA-N |
| XLogP | 3.12 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|