C21H22N4O5S3 — CID 41364419
4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41364419) has the molecular formula C21H22N4O5S3 and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41364419 |
| Molecular Formula | C21H22N4O5S3 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)C3CC3)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H22N4O5S3/c1-23(15-5-6-15)33(29,30)17-8-3-14(4-9-17)20(26)22-21-24(11-12-31-2)18-10-7-16(25(27)28)13-19(18)32-21/h3-4,7-10,13,15H,5-6,11-12H2,1-2H3/b22-21- |
| InChIKey | VQACUAZEBWRNQX-DQRAZIAOSA-N |
| XLogP | 3.50 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|