C22H22N4O7S2 — CID 16851697
ethyl 2-[2-[4-[cyclopropyl(methyl)sulfamoyl]benzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16851697) has the molecular formula C22H22N4O7S2 and a molecular weight of 518.57 g/mol. Its IUPAC name is ethyl 2-[2-[4-[cyclopropyl(methyl)sulfamoyl]benzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-[cyclopropyl(methyl)sulfamoyl]benzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16851697 |
| Molecular Formula | C22H22N4O7S2 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | ethyl 2-[2-[4-[cyclopropyl(methyl)sulfamoyl]benzoyl]imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)C3CC3)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H22N4O7S2/c1-3-33-20(27)13-25-18-12-16(26(29)30)8-11-19(18)34-22(25)23-21(28)14-4-9-17(10-5-14)35(31,32)24(2)15-6-7-15/h4-5,8-12,15H,3,6-7,13H2,1-2H3/b23-22- |
| InChIKey | BKIOZRGEFQZZHM-FCQUAONHSA-N |
| XLogP | 2.70 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|