C22H22N4O8S2 — CID 16851576
ethyl 2-[2-(4-morpholin-4-ylsulfonylbenzoyl)imino-5-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16851576) has the molecular formula C22H22N4O8S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is ethyl 2-[2-(4-morpholin-4-ylsulfonylbenzoyl)imino-5-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-morpholin-4-ylsulfonylbenzoyl)imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16851576 |
| Molecular Formula | C22H22N4O8S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | ethyl 2-[2-(4-morpholin-4-ylsulfonylbenzoyl)imino-5-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H22N4O8S2/c1-2-34-20(27)14-25-18-13-16(26(29)30)5-8-19(18)35-22(25)23-21(28)15-3-6-17(7-4-15)36(31,32)24-9-11-33-12-10-24/h3-8,13H,2,9-12,14H2,1H3/b23-22- |
| InChIKey | SASSHSGHOSHTKH-FCQUAONHSA-N |
| XLogP | 1.94 |
| TPSA | 150.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|