C23H25N3O5S2 — CID 3445161
ethyl 2-[2-(4-piperidin-1-ylsulfonylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 3445161) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is ethyl 2-[2-(4-piperidin-1-ylsulfonylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-piperidin-1-ylsulfonylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 3445161 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | ethyl 2-[2-(4-piperidin-1-ylsulfonylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C23H25N3O5S2/c1-2-31-21(27)16-26-19-8-4-5-9-20(19)32-23(26)24-22(28)17-10-12-18(13-11-17)33(29,30)25-14-6-3-7-15-25/h4-5,8-13H,2-3,6-7,14-16H2,1H3/b24-23- |
| InChIKey | BYDHXFUFYRFVNO-VHXPQNKSSA-N |
| XLogP | 3.18 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |