C22H21N3O3S2 — CID 5075459
4-piperidin-1-ylsulfonyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 5075459) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-piperidin-1-ylsulfonyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-piperidin-1-ylsulfonyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 5075459 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-piperidin-1-ylsulfonyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C22H21N3O3S2/c1-2-14-25-19-8-4-5-9-20(19)29-22(25)23-21(26)17-10-12-18(13-11-17)30(27,28)24-15-6-3-7-16-24/h1,4-5,8-13H,3,6-7,14-16H2/b23-22- |
| InChIKey | UBEOYJKWSFFISW-FCQUAONHSA-N |
| XLogP | 3.25 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|