C23H16FN3O3S2 — CID 121044589
4-[(4-fluorophenyl)sulfonylamino]-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121044589) has the molecular formula C23H16FN3O3S2 and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121044589 |
| Molecular Formula | C23H16FN3O3S2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C23H16FN3O3S2/c1-2-15-27-20-5-3-4-6-21(20)31-23(27)25-22(28)16-7-11-18(12-8-16)26-32(29,30)19-13-9-17(24)10-14-19/h1,3-14,26H,15H2/b25-23- |
| InChIKey | MHIWRAFBLNCBDK-BZZOAKBMSA-N |
| XLogP | 4.02 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|