C24H17Cl2N3O3S2 — CID 121044109
N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 121044109) has the molecular formula C24H17Cl2N3O3S2 and a molecular weight of 530.46 g/mol. Its IUPAC name is N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121044109 |
| Molecular Formula | C24H17Cl2N3O3S2 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.01 |
| IUPAC Name | N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C24H17Cl2N3O3S2/c1-3-14-29-21-19(25)12-13-20(26)22(21)33-24(29)27-23(30)16-6-8-17(9-7-16)28-34(31,32)18-10-4-15(2)5-11-18/h1,4-13,28H,14H2,2H3/b27-24- |
| InChIKey | BNUXFLMNJNXKSN-PNHLSOANSA-N |
| XLogP | 5.49 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|