C24H18ClN3O3S2 — CID 40886087
N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 40886087) has the molecular formula C24H18ClN3O3S2 and a molecular weight of 496.01 g/mol. Its IUPAC name is N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 40886087 |
| Molecular Formula | C24H18ClN3O3S2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2NS(=O)(=O)c2ccc(C)cc2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C24H18ClN3O3S2/c1-3-15-28-22-19(25)8-6-10-21(22)32-24(28)26-23(29)18-7-4-5-9-20(18)27-33(30,31)17-13-11-16(2)12-14-17/h1,4-14,27H,15H2,2H3/b26-24- |
| InChIKey | SHRCSGJNOFBANT-LCUIJRPUSA-N |
| XLogP | 4.84 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|