C24H20FN3O3S2 — CID 4671212
N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 4671212) has the molecular formula C24H20FN3O3S2 and a molecular weight of 481.57 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 4671212 |
| Molecular Formula | C24H20FN3O3S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccccc2NS(=O)(=O)c2ccc(C)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C24H20FN3O3S2/c1-3-14-28-21-13-10-17(25)15-22(21)32-24(28)26-23(29)19-6-4-5-7-20(19)27-33(30,31)18-11-8-16(2)9-12-18/h3-13,15,27H,1,14H2,2H3/b26-24- |
| InChIKey | HXQQLNKCMFJVFR-LCUIJRPUSA-N |
| XLogP | 4.88 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|