C24H22N4O5S3 — CID 121042558
3-[(4-methylphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121042558) has the molecular formula C24H22N4O5S3 and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121042558 |
| Molecular Formula | C24H22N4O5S3 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H22N4O5S3/c1-3-13-28-21-12-11-20(35(25,30)31)15-22(21)34-24(28)26-23(29)17-5-4-6-18(14-17)27-36(32,33)19-9-7-16(2)8-10-19/h3-12,14-15,27H,1,13H2,2H3,(H2,25,30,31)/b26-24- |
| InChIKey | MFPCOMRYNWBNAQ-LCUIJRPUSA-N |
| XLogP | 3.39 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|