C24H20ClN3O4S2 — CID 121043014
3-[(4-chlorophenyl)sulfonylamino]-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121043014) has the molecular formula C24H20ClN3O4S2 and a molecular weight of 514.03 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121043014 |
| Molecular Formula | C24H20ClN3O4S2 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(6-methoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C24H20ClN3O4S2/c1-3-13-28-21-12-9-19(32-2)15-22(21)33-24(28)26-23(29)16-5-4-6-18(14-16)27-34(30,31)20-10-7-17(25)8-11-20/h3-12,14-15,27H,1,13H2,2H3/b26-24- |
| InChIKey | ZXTRZBDKQDRTHS-LCUIJRPUSA-N |
| XLogP | 5.09 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|