C23H17ClFN3O3S2 — CID 121043017
3-[(4-chlorophenyl)sulfonylamino]-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121043017) has the molecular formula C23H17ClFN3O3S2 and a molecular weight of 501.99 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121043017 |
| Molecular Formula | C23H17ClFN3O3S2 |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(4-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)sc2cccc(F)c21 |
| InChI | InChI=1S/C23H17ClFN3O3S2/c1-2-13-28-21-19(25)7-4-8-20(21)32-23(28)26-22(29)15-5-3-6-17(14-15)27-33(30,31)18-11-9-16(24)10-12-18/h2-12,14,27H,1,13H2/b26-23- |
| InChIKey | CULGFWGQFSWDEF-RWEWTDSWSA-N |
| XLogP | 5.22 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|