C25H22ClN3O3S2 — CID 121045072
4-[(4-chlorophenyl)sulfonylamino]-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121045072) has the molecular formula C25H22ClN3O3S2 and a molecular weight of 512.06 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylamino]-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121045072 |
| Molecular Formula | C25H22ClN3O3S2 |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(6-ethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C25H22ClN3O3S2/c1-3-15-29-22-14-5-17(4-2)16-23(22)33-25(29)27-24(30)18-6-10-20(11-7-18)28-34(31,32)21-12-8-19(26)9-13-21/h3,5-14,16,28H,1,4,15H2,2H3/b27-25- |
| InChIKey | KXMUBZHFTCZQSD-RFBIWTDZSA-N |
| XLogP | 5.65 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|