C22H18ClN3O3S2 — CID 121043679
4-(benzenesulfonamido)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121043679) has the molecular formula C22H18ClN3O3S2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121043679 |
| Molecular Formula | C22H18ClN3O3S2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H18ClN3O3S2/c1-2-26-19-13-10-16(23)14-20(19)30-22(26)24-21(27)15-8-11-17(12-9-15)25-31(28,29)18-6-4-3-5-7-18/h3-14,25H,2H2,1H3/b24-22- |
| InChIKey | BRRJWIXSEXBSHH-GYHWCHFESA-N |
| XLogP | 4.92 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |