C24H22N4O6S3 — CID 121045447
4-[(4-methoxyphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121045447) has the molecular formula C24H22N4O6S3 and a molecular weight of 558.66 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[(4-methoxyphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121045447 |
| Molecular Formula | C24H22N4O6S3 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfonylamino]-N-(3-prop-2-enyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(OC)cc3)cc2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H22N4O6S3/c1-3-14-28-21-13-12-20(36(25,30)31)15-22(21)35-24(28)26-23(29)16-4-6-17(7-5-16)27-37(32,33)19-10-8-18(34-2)9-11-19/h3-13,15,27H,1,14H2,2H3,(H2,25,30,31)/b26-24- |
| InChIKey | HOYYSPVXCPHAIV-LCUIJRPUSA-N |
| XLogP | 3.09 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|