C28H29N3O4S2 — CID 121045488
N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[(4-methoxyphenyl)sulfonylamino]benzamide (PubChem CID 121045488) has the molecular formula C28H29N3O4S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[(4-methoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121045488 |
| Molecular Formula | C28H29N3O4S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | N-(6-butyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[(4-methoxyphenyl)sulfonylamino]benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(OC)cc3)cc2)sc2cc(CCCC)ccc21 |
| InChI | InChI=1S/C28H29N3O4S2/c1-4-6-7-20-8-17-25-26(19-20)36-28(31(25)18-5-2)29-27(32)21-9-11-22(12-10-21)30-37(33,34)24-15-13-23(35-3)14-16-24/h5,8-17,19,30H,2,4,6-7,18H2,1,3H3/b29-28- |
| InChIKey | WNWXFVTXHLVHML-ZIADKAODSA-N |
| XLogP | 5.78 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|