C25H23N3O5S2 — CID 121043843
4-(benzenesulfonamido)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 121043843) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 121043843 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H23N3O5S2/c1-4-14-28-20-15-21(32-2)22(33-3)16-23(20)34-25(28)26-24(29)17-10-12-18(13-11-17)27-35(30,31)19-8-6-5-7-9-19/h4-13,15-16,27H,1,14H2,2-3H3/b26-25- |
| InChIKey | XFUQMGCEFUOSPR-QPLCGJKRSA-N |
| XLogP | 4.45 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|