C25H25N5O5S2 — CID 43979245
4-[bis(2-cyanoethyl)sulfamoyl]-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43979245) has the molecular formula C25H25N5O5S2 and a molecular weight of 539.64 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43979245 |
| Molecular Formula | C25H25N5O5S2 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H25N5O5S2/c1-4-13-30-20-16-21(34-2)22(35-3)17-23(20)36-25(30)28-24(31)18-7-9-19(10-8-18)37(32,33)29(14-5-11-26)15-6-12-27/h4,7-10,16-17H,1,5-6,13-15H2,2-3H3/b28-25- |
| InChIKey | YQLJVIMCHRZLRS-FVDSYPCUSA-N |
| XLogP | 3.47 |
| TPSA | 137.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|