C26H29N3O7S2 — CID 43979308
ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 43979308) has the molecular formula C26H29N3O7S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43979308 |
| Molecular Formula | C26H29N3O7S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(OC)c(OC)cc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C26H29N3O7S2/c1-6-13-28(14-7-2)38(32,33)19-11-9-18(10-12-19)25(31)27-26-29(17-24(30)36-8-3)20-15-21(34-4)22(35-5)16-23(20)37-26/h6-7,9-12,15-16H,1-2,8,13-14,17H2,3-5H3/b27-26- |
| InChIKey | TXSDZMUIKORIDW-RQZHXJHFSA-N |
| XLogP | 3.39 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|