C25H27N3O6S2 — CID 43941641
ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-4-methoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941641) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-4-methoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-4-methoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941641 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | ethyl 2-[2-[4-[bis(prop-2-enyl)sulfamoyl]benzoyl]imino-4-methoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cccc(OC)c3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C25H27N3O6S2/c1-5-15-27(16-6-2)36(31,32)19-13-11-18(12-14-19)24(30)26-25-28(17-22(29)34-7-3)23-20(33-4)9-8-10-21(23)35-25/h5-6,8-14H,1-2,7,15-17H2,3-4H3/b26-25- |
| InChIKey | GSZNXXGPFSDKEM-QPLCGJKRSA-N |
| XLogP | 3.38 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|