C24H27N3O5S2 — CID 40886653
4-[bis(prop-2-enyl)sulfamoyl]-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 40886653) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 40886653 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cccc(OC)c3n2CCOC)cc1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-5-14-26(15-6-2)34(29,30)19-12-10-18(11-13-19)23(28)25-24-27(16-17-31-3)22-20(32-4)8-7-9-21(22)33-24/h5-13H,1-2,14-17H2,3-4H3/b25-24- |
| InChIKey | RPDDMGRYVSVGAW-IZHYLOQSSA-N |
| XLogP | 3.46 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|