C21H20BrN3O3S2 — CID 42388148
4-[bis(prop-2-enyl)sulfamoyl]-N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 42388148) has the molecular formula C21H20BrN3O3S2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 42388148 |
| Molecular Formula | C21H20BrN3O3S2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4-bromo-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cccc(Br)c3n2C)cc1 |
| InChI | InChI=1S/C21H20BrN3O3S2/c1-4-13-25(14-5-2)30(27,28)16-11-9-15(10-12-16)20(26)23-21-24(3)19-17(22)7-6-8-18(19)29-21/h4-12H,1-2,13-14H2,3H3/b23-21- |
| InChIKey | SDGIDFXYYJDGIG-LNVKXUELSA-N |
| XLogP | 4.11 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|