C22H22ClN3O3S2 — CID 5079934
4-[bis(prop-2-enyl)sulfamoyl]-N-(7-chloro-3,4-dimethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 5079934) has the molecular formula C22H22ClN3O3S2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-chloro-3,4-dimethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-chloro-3,4-dimethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 5079934 |
| Molecular Formula | C22H22ClN3O3S2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(7-chloro-3,4-dimethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3c(Cl)ccc(C)c3n2C)cc1 |
| InChI | InChI=1S/C22H22ClN3O3S2/c1-5-13-26(14-6-2)31(28,29)17-10-8-16(9-11-17)21(27)24-22-25(4)19-15(3)7-12-18(23)20(19)30-22/h5-12H,1-2,13-14H2,3-4H3/b24-22- |
| InChIKey | GYBQICJLXJQLOE-GYHWCHFESA-N |
| XLogP | 4.31 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|