C23H25N3O3S2 — CID 40996818
4-[bis(prop-2-enyl)sulfamoyl]-N-(6-ethyl-3-methyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40996818) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-ethyl-3-methyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-ethyl-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40996818 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-ethyl-3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(CC)ccc3n2C)cc1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-5-14-26(15-6-2)31(28,29)19-11-9-18(10-12-19)22(27)24-23-25(4)20-13-8-17(7-3)16-21(20)30-23/h5-6,8-13,16H,1-2,7,14-15H2,3-4H3/b24-23- |
| InChIKey | ZPQHONOTQGXBQZ-VHXPQNKSSA-N |
| XLogP | 3.91 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|