C24H27N3O5S3 — CID 43985122
4-[bis(prop-2-enyl)sulfamoyl]-N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43985122) has the molecular formula C24H27N3O5S3 and a molecular weight of 533.70 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43985122 |
| Molecular Formula | C24H27N3O5S3 |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-methylsulfonyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(S(C)(=O)=O)ccc3n2CCC)cc1 |
| InChI | InChI=1S/C24H27N3O5S3/c1-5-14-26(15-6-2)35(31,32)19-10-8-18(9-11-19)23(28)25-24-27(16-7-3)21-13-12-20(34(4,29)30)17-22(21)33-24/h5-6,8-13,17H,1-2,7,14-16H2,3-4H3/b25-24- |
| InChIKey | HTZSEUXDNHLZLT-IZHYLOQSSA-N |
| XLogP | 3.62 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|