C19H17ClN2O3S2 — CID 40952216
N-(7-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide (PubChem CID 40952216) has the molecular formula C19H17ClN2O3S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is N-(7-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide.
| Compound Name | N-(7-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 40952216 |
| Molecular Formula | C19H17ClN2O3S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-(7-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methylsulfonylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(C)(=O)=O)cc2)sc2c(Cl)ccc(C)c21 |
| InChI | InChI=1S/C19H17ClN2O3S2/c1-4-11-22-16-12(2)5-10-15(20)17(16)26-19(22)21-18(23)13-6-8-14(9-7-13)27(3,24)25/h4-10H,1,11H2,2-3H3/b21-19- |
| InChIKey | ZIPJPKHDGSUKMJ-VZCXRCSSSA-N |
| XLogP | 4.00 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|