C26H33N3O3S2 — CID 43944536
4-(dibutylsulfamoyl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944536) has the molecular formula C26H33N3O3S2 and a molecular weight of 499.70 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944536 |
| Molecular Formula | C26H33N3O3S2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCCC)CCCC)cc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C26H33N3O3S2/c1-5-8-18-28(19-9-6-2)34(31,32)22-15-13-21(14-16-22)25(30)27-26-29(17-7-3)24-20(4)11-10-12-23(24)33-26/h7,10-16H,3,5-6,8-9,17-19H2,1-2,4H3/b27-26- |
| InChIKey | VQBQNVICWJKVAW-RQZHXJHFSA-N |
| XLogP | 5.53 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|