C24H20N2OS — CID 43943680
N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-phenylbenzamide (PubChem CID 43943680) has the molecular formula C24H20N2OS and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-phenylbenzamide.
| Compound Name | N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-phenylbenzamide |
|---|---|
| PubChem CID | 43943680 |
| Molecular Formula | C24H20N2OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-phenylbenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(-c3ccccc3)cc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C24H20N2OS/c1-3-16-26-22-17(2)8-7-11-21(22)28-24(26)25-23(27)20-14-12-19(13-15-20)18-9-5-4-6-10-18/h3-15H,1,16H2,2H3/b25-24- |
| InChIKey | OEONQUYGILODDS-IZHYLOQSSA-N |
| XLogP | 5.61 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|