C17H17N3O3S — CID 123982903
2-(2,5-dihydroxypyrrol-1-yl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 123982903) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 123982903 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cn2c(O)ccc2O)sc2cccc(C)c21 |
| InChI | InChI=1S/C17H17N3O3S/c1-3-9-19-16-11(2)5-4-6-12(16)24-17(19)18-13(21)10-20-14(22)7-8-15(20)23/h3-8,22-23H,1,9-10H2,2H3/b18-17- |
| InChIKey | GMUYCQZJXMYQNV-ZCXUNETKSA-N |
| XLogP | 2.54 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|