C27H35N3O3S2 — CID 43944013
4-[bis(2-methylpropyl)sulfamoyl]-N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944013) has the molecular formula C27H35N3O3S2 and a molecular weight of 513.73 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944013 |
| Molecular Formula | C27H35N3O3S2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(4,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc2)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C27H35N3O3S2/c1-8-13-30-25-21(7)14-20(6)15-24(25)34-27(30)28-26(31)22-9-11-23(12-10-22)35(32,33)29(16-18(2)3)17-19(4)5/h8-12,14-15,18-19H,1,13,16-17H2,2-7H3/b28-27- |
| InChIKey | QIUYYWCUWGBPLG-DQSJHHFOSA-N |
| XLogP | 5.55 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|