C27H35N3O4S2 — CID 43944011
4-[bis(2-methylpropyl)sulfamoyl]-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944011) has the molecular formula C27H35N3O4S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944011 |
| Molecular Formula | C27H35N3O4S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(4-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C27H35N3O4S2/c1-7-16-30-25-23(34-8-2)10-9-11-24(25)35-27(30)28-26(31)21-12-14-22(15-13-21)36(32,33)29(17-19(3)4)18-20(5)6/h7,9-15,19-20H,1,8,16-18H2,2-6H3/b28-27- |
| InChIKey | SOLMLBHNAOWDGR-DQSJHHFOSA-N |
| XLogP | 5.33 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|